4-hydroxybutan-2-one;3-methoxypropanoic acid

C8H16O5 — CID 162245301

IUPAC4-hydroxybutan-2-one;3-methoxypropanoic acid
SMILESCC(=O)CCO.COCCC(=O)O
InChIInChI=1S/C4H8O3.C4H8O2/c1-7-3-2-4(5)6;1-4(6)2-3-5/h2-3H2,1H3,(H,5,6);5H,2-3H2,1H3
InChIKeyZXGGYEHUIJNIDQ-UHFFFAOYSA-N
MW192.21 g/mol
LogP0.07
Rot. Bonds5

About 4-hydroxybutan-2-one;3-methoxypropanoic acid

4-hydroxybutan-2-one;3-methoxypropanoic acid (PubChem CID 162245301) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 4-hydroxybutan-2-one;3-methoxypropanoic acid.

Molecular Properties

Compound Name4-hydroxybutan-2-one;3-methoxypropanoic acid
PubChem CID162245301
Molecular FormulaC8H16O5
Molecular Weight192.21 g/mol
Exact Mass192.10
IUPAC Name4-hydroxybutan-2-one;3-methoxypropanoic acid
SMILESCC(=O)CCO.COCCC(=O)O
InChIInChI=1S/C4H8O3.C4H8O2/c1-7-3-2-4(5)6;1-4(6)2-3-5/h2-3H2,1H3,(H,5,6);5H,2-3H2,1H3
InChIKeyZXGGYEHUIJNIDQ-UHFFFAOYSA-N
XLogP0.07
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.21
LogP ≤ 50.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-hydroxybutan-2-one;3-methoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxybutan-2-one;3-methoxypropanoic acid?
The IUPAC name of 4-hydroxybutan-2-one;3-methoxypropanoic acid (CID 162245301) is 4-hydroxybutan-2-one;3-methoxypropanoic acid.
What is the SMILES notation for 4-hydroxybutan-2-one;3-methoxypropanoic acid?
The canonical SMILES for 4-hydroxybutan-2-one;3-methoxypropanoic acid is CC(=O)CCO.COCCC(=O)O.
What is the InChIKey of 4-hydroxybutan-2-one;3-methoxypropanoic acid?
The InChIKey is ZXGGYEHUIJNIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C4H8O2/c1-7-3-2-4(5)6;1-4(6)2-3-5/h2-3H2,1H3,(H,5,6);5H,2-3H2,1H3.
What are the key properties of 4-hydroxybutan-2-one;3-methoxypropanoic acid?
4-hydroxybutan-2-one;3-methoxypropanoic acid has a molecular weight of 192.21 g/mol, XLogP of 0.07, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutan-2-one;3-methoxypropanoic acid is sourced from PubChem (CID 162245301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).