C8H16O5 — CID 162245301
4-hydroxybutan-2-one;3-methoxypropanoic acid (PubChem CID 162245301) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 4-hydroxybutan-2-one;3-methoxypropanoic acid.
| Compound Name | 4-hydroxybutan-2-one;3-methoxypropanoic acid |
|---|---|
| PubChem CID | 162245301 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-hydroxybutan-2-one;3-methoxypropanoic acid |
| SMILES | CC(=O)CCO.COCCC(=O)O |
| InChI | InChI=1S/C4H8O3.C4H8O2/c1-7-3-2-4(5)6;1-4(6)2-3-5/h2-3H2,1H3,(H,5,6);5H,2-3H2,1H3 |
| InChIKey | ZXGGYEHUIJNIDQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |