C25H18ClF3N6O6S — CID 162258362
3-chloro-4-nitrobenzoic acid;N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide (PubChem CID 162258362) has the molecular formula C25H18ClF3N6O6S and a molecular weight of 622.97 g/mol. Its IUPAC name is 3-chloro-4-nitrobenzoic acid;N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide.
| Compound Name | 3-chloro-4-nitrobenzoic acid;N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 162258362 |
| Molecular Formula | C25H18ClF3N6O6S |
| Molecular Weight | 622.97 g/mol |
| Exact Mass | 622.06 |
| IUPAC Name | 3-chloro-4-nitrobenzoic acid;N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide |
| SMILES | CNC(=O)c1ccc2nc(Nc3nc4ccc(OC(F)(F)F)cc4s3)n(C)c2c1.O=C(O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C18H14F3N5O2S.C7H4ClNO4/c1-22-15(27)9-3-5-11-13(7-9)26(2)16(23-11)25-17-24-12-6-4-10(8-14(12)29-17)28-18(19,20)21;8-5-3-4(7(10)11)1-2-6(5)9(12)13/h3-8H,1-2H3,(H,22,27)(H,23,24,25);1-3H,(H,10,11) |
| InChIKey | ZYXAWPYOWRDNSO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 161.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.97 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|