C27H27ClF3N7O4 — CID 162261899
5-(4-chlorophenyl)-2-[[1-[2-[3-(oxan-2-yl)-2-oxopropyl]-3-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 162261899) has the molecular formula C27H27ClF3N7O4 and a molecular weight of 606.01 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-[2-[3-(oxan-2-yl)-2-oxopropyl]-3-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-[2-[3-(oxan-2-yl)-2-oxopropyl]-3-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 162261899 |
| Molecular Formula | C27H27ClF3N7O4 |
| Molecular Weight | 606.01 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-[2-[3-(oxan-2-yl)-2-oxopropyl]-3-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | O=C(Cc1ncccc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1)CC1CCCCO1 |
| InChI | InChI=1S/C27H27ClF3N7O4/c28-18-8-6-17(7-9-18)25-35-37(26(41)36(25)14-23(40)27(29,30)31)15-24-33-16-38(34-24)22-5-3-10-32-21(22)13-19(39)12-20-4-1-2-11-42-20/h3,5-10,16,20,23,40H,1-2,4,11-15H2/t20?,23-/m0/s1 |
| InChIKey | ZZJAYCPSQROVLT-AKRCKQFNSA-N |
| XLogP | 3.38 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.01 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |