About 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine
5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine (PubChem CID 162270870) has the molecular formula C11H21NS
and a molecular weight of 199.36 g/mol. Its IUPAC name is 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine.
Analyze 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine?
The IUPAC name of 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine (CID 162270870) is 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine.
What is the SMILES notation for 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine?
The canonical SMILES for 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine is CC(C)C1=C(C(C)C)NCCSC1.
What is the InChIKey of 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine?
The InChIKey is MTTBJZVTQAPHKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NS/c1-8(2)10-7-13-6-5-12-11(10)9(3)4/h8-9,12H,5-7H2,1-4H3.
What are the key properties of 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine?
5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine has a molecular weight of 199.36 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-di(propan-2-yl)-2,3,4,7-tetrahydro-1,4-thiazepine is sourced from PubChem (CID 162270870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).