C11H19NS — CID 54109928
6-(3-methylbut-2-enyl)-5-methylidene-1,4-thiazepane (PubChem CID 54109928) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 6-(3-methylbut-2-enyl)-5-methylidene-1,4-thiazepane.
| Compound Name | 6-(3-methylbut-2-enyl)-5-methylidene-1,4-thiazepane |
|---|---|
| PubChem CID | 54109928 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 6-(3-methylbut-2-enyl)-5-methylidene-1,4-thiazepane |
| SMILES | C=C1NCCSCC1CC=C(C)C |
| InChI | InChI=1S/C11H19NS/c1-9(2)4-5-11-8-13-7-6-12-10(11)3/h4,11-12H,3,5-8H2,1-2H3 |
| InChIKey | NGJRAVOEZBCRMT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|