C14H23NS — CID 145258815
N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2,4-dimethylpent-1-en-3-amine (PubChem CID 145258815) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2,4-dimethylpent-1-en-3-amine.
| Compound Name | N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2,4-dimethylpent-1-en-3-amine |
|---|---|
| PubChem CID | 145258815 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2,4-dimethylpent-1-en-3-amine |
| SMILES | C=C(CC1=CCCS1)NC(C(=C)C)C(C)C |
| InChI | InChI=1S/C14H23NS/c1-10(2)14(11(3)4)15-12(5)9-13-7-6-8-16-13/h7,11,14-15H,1,5-6,8-9H2,2-4H3 |
| InChIKey | NZDMYZRPELNCBU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|