C25H44N2S — CID 134568496
1-N-prop-1-en-2-yl-3-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-3-ene-1,3-diamine (PubChem CID 134568496) has the molecular formula C25H44N2S and a molecular weight of 404.71 g/mol. Its IUPAC name is 1-N-prop-1-en-2-yl-3-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-3-ene-1,3-diamine.
| Compound Name | 1-N-prop-1-en-2-yl-3-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 134568496 |
| Molecular Formula | C25H44N2S |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 1-N-prop-1-en-2-yl-3-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-3-ene-1,3-diamine |
| SMILES | C=C(C)NCCC(=C)NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H44N2S/c1-20(2)11-9-12-22(5)13-10-14-23(6)16-18-28-19-25(8)27-24(7)15-17-26-21(3)4/h11,13,16,25-27H,3,7,9-10,12,14-15,17-19H2,1-2,4-6,8H3/b22-13+,23-16+ |
| InChIKey | ZUZHQXURYFHFFR-WRXOINPPSA-N |
| XLogP | 7.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|