C30H52N2S — CID 134568463
5-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-3-N-prop-1-en-2-ylhex-1-ene-2,3-diamine (PubChem CID 134568463) has the molecular formula C30H52N2S and a molecular weight of 472.83 g/mol. Its IUPAC name is 5-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-3-N-prop-1-en-2-ylhex-1-ene-2,3-diamine.
| Compound Name | 5-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-3-N-prop-1-en-2-ylhex-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 134568463 |
| Molecular Formula | C30H52N2S |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | 5-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-3-N-prop-1-en-2-ylhex-1-ene-2,3-diamine |
| SMILES | C=C(C)NC(CC(C)C)C(=C)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=C)C |
| InChI | InChI=1S/C30H52N2S/c1-22(2)14-12-15-26(9)16-13-17-27(10)18-19-33-21-30(24(5)6)32-28(11)29(20-23(3)4)31-25(7)8/h14,16,18,23,29-32H,5,7,11-13,15,17,19-21H2,1-4,6,8-10H3/b26-16+,27-18+ |
| InChIKey | KXHLFKYNEMCHCC-PDXRHTQTSA-N |
| XLogP | 8.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|