C31H56N2S — CID 143996679
3-N-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hept-1-ene-2,3-diamine;prop-1-ene (PubChem CID 143996679) has the molecular formula C31H56N2S and a molecular weight of 488.87 g/mol. Its IUPAC name is 3-N-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hept-1-ene-2,3-diamine;prop-1-ene.
| Compound Name | 3-N-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hept-1-ene-2,3-diamine;prop-1-ene |
|---|---|
| PubChem CID | 143996679 |
| Molecular Formula | C31H56N2S |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 488.42 |
| IUPAC Name | 3-N-methyl-2-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hept-1-ene-2,3-diamine;prop-1-ene |
| SMILES | C=C(C)C(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)NC(=C)C(CCCC)NC.C=CC |
| InChI | InChI=1S/C28H50N2S.C3H6/c1-10-11-18-27(29-9)26(8)30-28(23(4)5)21-31-20-19-25(7)17-13-16-24(6)15-12-14-22(2)3;1-3-2/h14,16,19,27-30H,4,8,10-13,15,17-18,20-21H2,1-3,5-7,9H3;3H,1H2,2H3/b24-16+,25-19+; |
| InChIKey | CVCLCOGQRBWJEA-VFLMRCQXSA-N |
| XLogP | 9.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|