C29H52N4S — CID 134568377
(4S)-3-N-tert-butyl-2-N-[(7Z)-7-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylidene-3,5,6,9-tetrahydro-2H-1,5,6-thiadiazonin-3-yl]-4-methylhex-1-ene-2,3-diamine (PubChem CID 134568377) has the molecular formula C29H52N4S and a molecular weight of 488.83 g/mol. Its IUPAC name is (4S)-3-N-tert-butyl-2-N-[(7Z)-7-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylidene-3,5,6,9-tetrahydro-2H-1,5,6-thiadiazonin-3-yl]-4-methylhex-1-ene-2,3-diamine.
| Compound Name | (4S)-3-N-tert-butyl-2-N-[(7Z)-7-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylidene-3,5,6,9-tetrahydro-2H-1,5,6-thiadiazonin-3-yl]-4-methylhex-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 134568377 |
| Molecular Formula | C29H52N4S |
| Molecular Weight | 488.83 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | (4S)-3-N-tert-butyl-2-N-[(7Z)-7-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylidene-3,5,6,9-tetrahydro-2H-1,5,6-thiadiazonin-3-yl]-4-methylhex-1-ene-2,3-diamine |
| SMILES | C=C1NN/C(CC/C=C(\C)CCC=C(C)C)=C\CSCC1NC(=C)C(NC(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C29H52N4S/c1-11-23(5)28(31-29(8,9)10)25(7)30-27-20-34-19-18-26(33-32-24(27)6)17-13-16-22(4)15-12-14-21(2)3/h14,16,18,23,27-28,30-33H,6-7,11-13,15,17,19-20H2,1-5,8-10H3/b22-16+,26-18-/t23-,27?,28?/m0/s1 |
| InChIKey | WDHRTFILGGYQDY-XANFKCAQSA-N |
| XLogP | 6.97 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.83 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|