C25H44N4S — CID 134568436
5-N-[1-[(2Z,6E)-7,11-dimethyl-3-(2-methylhydrazinyl)dodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-diene-2,5-diamine (PubChem CID 134568436) has the molecular formula C25H44N4S and a molecular weight of 432.72 g/mol. Its IUPAC name is 5-N-[1-[(2Z,6E)-7,11-dimethyl-3-(2-methylhydrazinyl)dodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-diene-2,5-diamine.
| Compound Name | 5-N-[1-[(2Z,6E)-7,11-dimethyl-3-(2-methylhydrazinyl)dodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-diene-2,5-diamine |
|---|---|
| PubChem CID | 134568436 |
| Molecular Formula | C25H44N4S |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.33 |
| IUPAC Name | 5-N-[1-[(2Z,6E)-7,11-dimethyl-3-(2-methylhydrazinyl)dodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-diene-2,5-diamine |
| SMILES | C=CC(CSC/C=C(/CC/C=C(\C)CCC=C(C)C)NNC)NC(=C)CCC(=C)N |
| InChI | InChI=1S/C25H44N4S/c1-8-24(28-23(6)16-15-22(5)26)19-30-18-17-25(29-27-7)14-10-13-21(4)12-9-11-20(2)3/h8,11,13,17,24,27-29H,1,5-6,9-10,12,14-16,18-19,26H2,2-4,7H3/b21-13+,25-17- |
| InChIKey | ARRYHMQPJNJMBZ-IWGNHRMASA-N |
| XLogP | 5.71 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|