C27H46N2S — CID 146359034
1-N-ethenyl-4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]pent-4-ene-1,4-diamine (PubChem CID 146359034) has the molecular formula C27H46N2S and a molecular weight of 430.75 g/mol. Its IUPAC name is 1-N-ethenyl-4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]pent-4-ene-1,4-diamine.
| Compound Name | 1-N-ethenyl-4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]pent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 146359034 |
| Molecular Formula | C27H46N2S |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | 1-N-ethenyl-4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]pent-4-ene-1,4-diamine |
| SMILES | C=CNCCCC(=C)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=C)C |
| InChI | InChI=1S/C27H46N2S/c1-9-28-19-12-17-26(8)29-27(23(4)5)21-30-20-18-25(7)16-11-15-24(6)14-10-13-22(2)3/h9,13,15,18,27-29H,1,4,8,10-12,14,16-17,19-21H2,2-3,5-7H3/b24-15+,25-18+ |
| InChIKey | ZQURKDSUZKLFLL-NZCNRJORSA-N |
| XLogP | 7.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|