C16H32N2S — CID 142083729
ethane;(1Z,3E)-2-N-ethyl-4,8-dimethyl-1-methylsulfanylnona-1,3,7-triene-2,5-diamine (PubChem CID 142083729) has the molecular formula C16H32N2S and a molecular weight of 284.51 g/mol. Its IUPAC name is ethane;(1Z,3E)-2-N-ethyl-4,8-dimethyl-1-methylsulfanylnona-1,3,7-triene-2,5-diamine.
| Compound Name | ethane;(1Z,3E)-2-N-ethyl-4,8-dimethyl-1-methylsulfanylnona-1,3,7-triene-2,5-diamine |
|---|---|
| PubChem CID | 142083729 |
| Molecular Formula | C16H32N2S |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | ethane;(1Z,3E)-2-N-ethyl-4,8-dimethyl-1-methylsulfanylnona-1,3,7-triene-2,5-diamine |
| SMILES | CC.CCNC(=C\SC)/C=C(\C)C(N)CC=C(C)C |
| InChI | InChI=1S/C14H26N2S.C2H6/c1-6-16-13(10-17-5)9-12(4)14(15)8-7-11(2)3;1-2/h7,9-10,14,16H,6,8,15H2,1-5H3;1-2H3/b12-9+,13-10-; |
| InChIKey | PAYUJQUWQOMOBR-NFXVLDNISA-N |
| XLogP | 4.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|