C22H42N2S — CID 143796788
ethane;(2E,6Z)-N-ethyl-4,5-dimethylideneocta-2,6-dien-2-amine;N-ethylsulfanylcyclohexanamine (PubChem CID 143796788) has the molecular formula C22H42N2S and a molecular weight of 366.66 g/mol. Its IUPAC name is ethane;(2E,6Z)-N-ethyl-4,5-dimethylideneocta-2,6-dien-2-amine;N-ethylsulfanylcyclohexanamine.
| Compound Name | ethane;(2E,6Z)-N-ethyl-4,5-dimethylideneocta-2,6-dien-2-amine;N-ethylsulfanylcyclohexanamine |
|---|---|
| PubChem CID | 143796788 |
| Molecular Formula | C22H42N2S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | ethane;(2E,6Z)-N-ethyl-4,5-dimethylideneocta-2,6-dien-2-amine;N-ethylsulfanylcyclohexanamine |
| SMILES | C=C(/C=C\C)C(=C)/C=C(\C)NCC.CC.CCSNC1CCCCC1 |
| InChI | InChI=1S/C12H19N.C8H17NS.C2H6/c1-6-8-10(3)11(4)9-12(5)13-7-2;1-2-10-9-8-6-4-3-5-7-8;1-2/h6,8-9,13H,3-4,7H2,1-2,5H3;8-9H,2-7H2,1H3;1-2H3/b8-6-,12-9+;; |
| InChIKey | FYBIJZAHMBVRPU-JMLAAAMTSA-N |
| XLogP | 6.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|