C30H49NS — CID 143996586
(2E,4E)-5,6-dimethyl-N-[(E)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-1-en-2-yl]hepta-2,4,6-trien-3-amine;prop-1-ene (PubChem CID 143996586) has the molecular formula C30H49NS and a molecular weight of 455.80 g/mol. Its IUPAC name is (2E,4E)-5,6-dimethyl-N-[(E)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-1-en-2-yl]hepta-2,4,6-trien-3-amine;prop-1-ene.
| Compound Name | (2E,4E)-5,6-dimethyl-N-[(E)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-1-en-2-yl]hepta-2,4,6-trien-3-amine;prop-1-ene |
|---|---|
| PubChem CID | 143996586 |
| Molecular Formula | C30H49NS |
| Molecular Weight | 455.80 g/mol |
| Exact Mass | 455.36 |
| IUPAC Name | (2E,4E)-5,6-dimethyl-N-[(E)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylprop-1-en-2-yl]hepta-2,4,6-trien-3-amine;prop-1-ene |
| SMILES | C=C(C)/C(C)=C/C(=C\C)N/C(C)=C/SC/C=C(\C)CC/C=C(\C)CCC=C(C)C.C=CC |
| InChI | InChI=1S/C27H43NS.C3H6/c1-10-27(19-25(8)22(4)5)28-26(9)20-29-18-17-24(7)16-12-15-23(6)14-11-13-21(2)3;1-3-2/h10,13,15,17,19-20,28H,4,11-12,14,16,18H2,1-3,5-9H3;3H,1H2,2H3/b23-15+,24-17+,25-19+,26-20+,27-10+; |
| InChIKey | KFVUCYLNKFVLCC-FOBOHBQVSA-N |
| XLogP | 10.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.80 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|