C24H33N — CID 139469127
(3Z,5E,7E,9Z)-7-ethenyl-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-1,3,5,7,9-pentaen-2-amine (PubChem CID 139469127) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is (3Z,5E,7E,9Z)-7-ethenyl-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-1,3,5,7,9-pentaen-2-amine.
| Compound Name | (3Z,5E,7E,9Z)-7-ethenyl-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-1,3,5,7,9-pentaen-2-amine |
|---|---|
| PubChem CID | 139469127 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (3Z,5E,7E,9Z)-7-ethenyl-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-1,3,5,7,9-pentaen-2-amine |
| SMILES | C=CC(/C(C)=C\C(=C\C(=C)NC(=C)C)\C(=C/C)C(=C)C)=C(C)\C=C/C |
| InChI | InChI=1S/C24H33N/c1-11-14-19(8)24(13-3)20(9)15-22(23(12-2)17(4)5)16-21(10)25-18(6)7/h11-16,25H,3-4,6,10H2,1-2,5,7-9H3/b14-11-,20-15+,22-16-,23-12-,24-19+ |
| InChIKey | IMFYJGGWOYKAOI-VXBAXTEZSA-N |
| XLogP | 7.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|