C18H27NS — CID 145230265
N-cyclohexa-1,5-dien-1-yl-6-methylsulfanylcyclohexa-1,5-dien-1-amine;pent-1-ene (PubChem CID 145230265) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-6-methylsulfanylcyclohexa-1,5-dien-1-amine;pent-1-ene.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-6-methylsulfanylcyclohexa-1,5-dien-1-amine;pent-1-ene |
|---|---|
| PubChem CID | 145230265 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-6-methylsulfanylcyclohexa-1,5-dien-1-amine;pent-1-ene |
| SMILES | C=CCCC.CSC1=CCCC=C1NC1=CCCC=C1 |
| InChI | InChI=1S/C13H17NS.C5H10/c1-15-13-10-6-5-9-12(13)14-11-7-3-2-4-8-11;1-3-5-4-2/h3,7-10,14H,2,4-6H2,1H3;3H,1,4-5H2,2H3 |
| InChIKey | UFJWMNXSKBQDJD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|