C11H23NS — CID 143902098
ethane;2-methylsulfanylcyclohexa-1,5-dien-1-amine (PubChem CID 143902098) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is ethane;2-methylsulfanylcyclohexa-1,5-dien-1-amine.
| Compound Name | ethane;2-methylsulfanylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 143902098 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | ethane;2-methylsulfanylcyclohexa-1,5-dien-1-amine |
| SMILES | CC.CC.CSC1=C(N)C=CCC1 |
| InChI | InChI=1S/C7H11NS.2C2H6/c1-9-7-5-3-2-4-6(7)8;2*1-2/h2,4H,3,5,8H2,1H3;2*1-2H3 |
| InChIKey | WKLYIQFVAOYQQA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |