C7H12N2S — CID 70422302
1-methylsulfanylcyclohexa-3,5-diene-1,3-diamine (PubChem CID 70422302) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 1-methylsulfanylcyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 1-methylsulfanylcyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 70422302 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1-methylsulfanylcyclohexa-3,5-diene-1,3-diamine |
| SMILES | CSC1(N)C=CC=C(N)C1 |
| InChI | InChI=1S/C7H12N2S/c1-10-7(9)4-2-3-6(8)5-7/h2-4H,5,8-9H2,1H3 |
| InChIKey | UUMDKGMEHWBZQB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|