C23H36F3NS — CID 134568458
(3E)-5,5,5-trifluoro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]penta-1,3-dien-2-amine (PubChem CID 134568458) has the molecular formula C23H36F3NS and a molecular weight of 415.61 g/mol. Its IUPAC name is (3E)-5,5,5-trifluoro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]penta-1,3-dien-2-amine.
| Compound Name | (3E)-5,5,5-trifluoro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 134568458 |
| Molecular Formula | C23H36F3NS |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (3E)-5,5,5-trifluoro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]penta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/C(F)(F)F)NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H36F3NS/c1-18(2)9-7-10-19(3)11-8-12-20(4)14-16-28-17-22(6)27-21(5)13-15-23(24,25)26/h9,11,13-15,22,27H,5,7-8,10,12,16-17H2,1-4,6H3/b15-13+,19-11+,20-14+ |
| InChIKey | YVOOKLNBISGJHT-RXWWLNCDSA-N |
| XLogP | 7.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|