C26H38N2O3 — CID 162272043
methyl 1-[2-(4-benzylpiperidin-1-yl)propanoylamino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate (PubChem CID 162272043) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is methyl 1-[2-(4-benzylpiperidin-1-yl)propanoylamino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate.
| Compound Name | methyl 1-[2-(4-benzylpiperidin-1-yl)propanoylamino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 162272043 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | methyl 1-[2-(4-benzylpiperidin-1-yl)propanoylamino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2C1NC(=O)C(C)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H38N2O3/c1-18(28-14-12-20(13-15-28)16-19-8-4-3-5-9-19)25(29)27-24-22-11-7-6-10-21(22)17-23(24)26(30)31-2/h3-5,8-9,18,20-24H,6-7,10-17H2,1-2H3,(H,27,29) |
| InChIKey | KQSOWQBXEFKLJP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |