C24H34N2O3 — CID 162272059
methyl 1-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate (PubChem CID 162272059) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is methyl 1-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate.
| Compound Name | methyl 1-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 162272059 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | methyl 1-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2C1NC(=O)CN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N2O3/c1-29-24(28)21-15-19-9-5-6-10-20(19)23(21)25-22(27)16-26-13-11-18(12-14-26)17-7-3-2-4-8-17/h2-4,7-8,18-21,23H,5-6,9-16H2,1H3,(H,25,27) |
| InChIKey | WGSZGGBTCVVAAX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |