C32H45NO3 — CID 162278143
(E)-6-(4-butoxyphenyl)-5-cyclopentyl-6-[4-[3-(dimethylamino)propoxy]phenyl]hex-5-en-2-one (PubChem CID 162278143) has the molecular formula C32H45NO3 and a molecular weight of 491.72 g/mol. Its IUPAC name is (E)-6-(4-butoxyphenyl)-5-cyclopentyl-6-[4-[3-(dimethylamino)propoxy]phenyl]hex-5-en-2-one.
| Compound Name | (E)-6-(4-butoxyphenyl)-5-cyclopentyl-6-[4-[3-(dimethylamino)propoxy]phenyl]hex-5-en-2-one |
|---|---|
| PubChem CID | 162278143 |
| Molecular Formula | C32H45NO3 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | (E)-6-(4-butoxyphenyl)-5-cyclopentyl-6-[4-[3-(dimethylamino)propoxy]phenyl]hex-5-en-2-one |
| SMILES | CCCCOc1ccc(/C(=C(/CCC(C)=O)C2CCCC2)c2ccc(OCCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H45NO3/c1-5-6-23-35-29-17-13-27(14-18-29)32(31(21-12-25(2)34)26-10-7-8-11-26)28-15-19-30(20-16-28)36-24-9-22-33(3)4/h13-20,26H,5-12,21-24H2,1-4H3/b32-31+ |
| InChIKey | AHBHJJFYIZIOFY-QNEJGDQOSA-N |
| XLogP | 7.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|