C26H35F2N3O3 — CID 162278220
(1R)-2-acetyl-7-fluoro-N-(2-fluorophenyl)-1-(hydroxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide (PubChem CID 162278220) has the molecular formula C26H35F2N3O3 and a molecular weight of 475.58 g/mol. Its IUPAC name is (1R)-2-acetyl-7-fluoro-N-(2-fluorophenyl)-1-(hydroxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (1R)-2-acetyl-7-fluoro-N-(2-fluorophenyl)-1-(hydroxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 162278220 |
| Molecular Formula | C26H35F2N3O3 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | (1R)-2-acetyl-7-fluoro-N-(2-fluorophenyl)-1-(hydroxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
| SMILES | CC(=O)N1CC2(CCN(C(=O)Nc3ccccc3F)CC2)C2C3CCC(F)CC3CC2[C@@H]1CO |
| InChI | InChI=1S/C26H35F2N3O3/c1-16(33)31-15-26(24-19-7-6-18(27)12-17(19)13-20(24)23(31)14-32)8-10-30(11-9-26)25(34)29-22-5-3-2-4-21(22)28/h2-5,17-20,23-24,32H,6-15H2,1H3,(H,29,34)/t17?,18?,19?,20?,23-,24?/m0/s1 |
| InChIKey | PDOBFHTVRFEYHK-YWIDCLPFSA-N |
| XLogP | 4.05 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |