C31H46FN3O6 — CID 146899636
(1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(2-methoxyethoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide (PubChem CID 146899636) has the molecular formula C31H46FN3O6 and a molecular weight of 575.72 g/mol. Its IUPAC name is (1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(2-methoxyethoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(2-methoxyethoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 146899636 |
| Molecular Formula | C31H46FN3O6 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | (1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(2-methoxyethoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
| SMILES | COCCOCOC[C@H]1C2CC3CC(OC)CCC3C2C2(CCN(C(=O)Nc3ccccc3F)CC2)CN1C(C)=O |
| InChI | InChI=1S/C31H46FN3O6/c1-21(36)35-19-31(10-12-34(13-11-31)30(37)33-27-7-5-4-6-26(27)32)29-24-9-8-23(39-3)16-22(24)17-25(29)28(35)18-41-20-40-15-14-38-2/h4-7,22-25,28-29H,8-20H2,1-3H3,(H,33,37)/t22?,23?,24?,25?,28-,29?/m0/s1 |
| InChIKey | MEINSZWCVCZLRT-QQORLLPDSA-N |
| XLogP | 4.38 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|