About 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole
2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole (PubChem CID 162279365) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole.
Molecular Properties
| Compound Name | 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole |
| PubChem CID | 162279365 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole |
| SMILES | CC(C)(C)C1=NC=CC1.CC(C)(C)C1=NCC=C1 |
| InChI | InChI=1S/2C8H13N/c2*1-8(2,3)7-5-4-6-9-7/h4,6H,5H2,1-3H3;4-5H,6H2,1-3H3 |
| InChIKey | BQYNVWKXMKZJNA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole?
The IUPAC name of 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole (CID 162279365) is 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole.
What is the SMILES notation for 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole?
The canonical SMILES for 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole is CC(C)(C)C1=NC=CC1.CC(C)(C)C1=NCC=C1.
What is the InChIKey of 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole?
The InChIKey is BQYNVWKXMKZJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H13N/c2*1-8(2,3)7-5-4-6-9-7/h4,6H,5H2,1-3H3;4-5H,6H2,1-3H3.
What are the key properties of 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole?
2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole has a molecular weight of 246.40 g/mol, XLogP of 4.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3H-pyrrole;5-tert-butyl-2H-pyrrole is sourced from PubChem (CID 162279365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).