C23H45NSi — CID 162279509
N-[2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalen-3-yl(dimethyl)silyl]-N-tert-butyl-2-methylpropan-2-amine (PubChem CID 162279509) has the molecular formula C23H45NSi and a molecular weight of 363.71 g/mol. Its IUPAC name is N-[2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalen-3-yl(dimethyl)silyl]-N-tert-butyl-2-methylpropan-2-amine.
| Compound Name | N-[2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalen-3-yl(dimethyl)silyl]-N-tert-butyl-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 162279509 |
| Molecular Formula | C23H45NSi |
| Molecular Weight | 363.71 g/mol |
| Exact Mass | 363.33 |
| IUPAC Name | N-[2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalen-3-yl(dimethyl)silyl]-N-tert-butyl-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N(C(C)(C)C)[Si](C)(C)C1CCC2CC3CCCCC3CC21 |
| InChI | InChI=1S/C23H45NSi/c1-22(2,3)24(23(4,5)6)25(7,8)21-14-13-19-15-17-11-9-10-12-18(17)16-20(19)21/h17-21H,9-16H2,1-8H3 |
| InChIKey | KJBFMSGISDTXIO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.71 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|