C17H35NSi — CID 123708052
N-[dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl)silyl]-N,2-dimethylpropan-2-amine (PubChem CID 123708052) has the molecular formula C17H35NSi and a molecular weight of 281.56 g/mol. Its IUPAC name is N-[dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl)silyl]-N,2-dimethylpropan-2-amine.
| Compound Name | N-[dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl)silyl]-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 123708052 |
| Molecular Formula | C17H35NSi |
| Molecular Weight | 281.56 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | N-[dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl)silyl]-N,2-dimethylpropan-2-amine |
| SMILES | CC1CC2CCCC([Si](C)(C)N(C)C(C)(C)C)C2C1 |
| InChI | InChI=1S/C17H35NSi/c1-13-11-14-9-8-10-16(15(14)12-13)19(6,7)18(5)17(2,3)4/h13-16H,8-12H2,1-7H3 |
| InChIKey | DAOAAOJTUKDVAC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|