C8H7N3O — CID 16228097
3-(1,3,4-Oxadiazol-2-yl)aniline (PubChem CID 16228097) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | 3-(1,3,4-Oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 16228097 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | C1=CC(=CC(=C1)N)C2=NN=CO2 |
| InChI | InChI=1S/C8H7N3O/c9-7-3-1-2-6(4-7)8-11-10-5-12-8/h1-5H,9H2 |
| InChIKey | BNGIMWCROMYOKW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 153 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|