C15H12N4O2 — CID 2739470
1-[3-(1,3,4-oxadiazol-2-yl)phenyl]-3-phenylurea (PubChem CID 2739470) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 1-[3-(1,3,4-oxadiazol-2-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[3-(1,3,4-oxadiazol-2-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 2739470 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[3-(1,3,4-oxadiazol-2-yl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(-c2nnco2)c1 |
| InChI | InChI=1S/C15H12N4O2/c20-15(17-12-6-2-1-3-7-12)18-13-8-4-5-11(9-13)14-19-16-10-21-14/h1-10H,(H2,17,18,20) |
| InChIKey | MLYPBJPWTKQTBG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |