C26H27N3OS — CID 162283221
2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-[3-[2-(2-methyl-1,3-thiazol-5-yl)ethynyl]phenyl]ethanone (PubChem CID 162283221) has the molecular formula C26H27N3OS and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-[3-[2-(2-methyl-1,3-thiazol-5-yl)ethynyl]phenyl]ethanone.
| Compound Name | 2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-[3-[2-(2-methyl-1,3-thiazol-5-yl)ethynyl]phenyl]ethanone |
|---|---|
| PubChem CID | 162283221 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-[3-[2-(2-methyl-1,3-thiazol-5-yl)ethynyl]phenyl]ethanone |
| SMILES | Cc1ncc(C#Cc2cccc(C(=O)Cc3ccc(CN4CCN(C)CC4)cc3)c2)s1 |
| InChI | InChI=1S/C26H27N3OS/c1-20-27-18-25(31-20)11-10-21-4-3-5-24(16-21)26(30)17-22-6-8-23(9-7-22)19-29-14-12-28(2)13-15-29/h3-9,16,18H,12-15,17,19H2,1-2H3 |
| InChIKey | QMGFXIQQLDKEJF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|