C24H43O2P3 — CID 162284336
(1-deca-4,7-dienyl-8-phosphanyloxytetradeca-2,4,6-trienoxy)-phosphanylphosphane (PubChem CID 162284336) has the molecular formula C24H43O2P3 and a molecular weight of 456.53 g/mol. Its IUPAC name is (1-deca-4,7-dienyl-8-phosphanyloxytetradeca-2,4,6-trienoxy)-phosphanylphosphane.
| Compound Name | (1-deca-4,7-dienyl-8-phosphanyloxytetradeca-2,4,6-trienoxy)-phosphanylphosphane |
|---|---|
| PubChem CID | 162284336 |
| Molecular Formula | C24H43O2P3 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (1-deca-4,7-dienyl-8-phosphanyloxytetradeca-2,4,6-trienoxy)-phosphanylphosphane |
| SMILES | CCC=CCC=CCCCC(C=CC=CC=CC(CCCCCC)OP)OPP |
| InChI | InChI=1S/C24H43O2P3/c1-3-5-7-9-10-11-12-17-21-24(26-29-28)22-18-14-13-16-20-23(25-27)19-15-8-6-4-2/h5,7,10-11,13-14,16,18,20,22-24,29H,3-4,6,8-9,12,15,17,19,21,27-28H2,1-2H3 |
| InChIKey | VHVKGRQYXHQBCF-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|