C23H37O3P3 — CID 90985797
11-(diphosphanyloxy)-18-phosphanyloxytricosa-5,8,12,14,16,20-hexaen-2-one (PubChem CID 90985797) has the molecular formula C23H37O3P3 and a molecular weight of 454.47 g/mol. Its IUPAC name is 11-(diphosphanyloxy)-18-phosphanyloxytricosa-5,8,12,14,16,20-hexaen-2-one.
| Compound Name | 11-(diphosphanyloxy)-18-phosphanyloxytricosa-5,8,12,14,16,20-hexaen-2-one |
|---|---|
| PubChem CID | 90985797 |
| Molecular Formula | C23H37O3P3 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 11-(diphosphanyloxy)-18-phosphanyloxytricosa-5,8,12,14,16,20-hexaen-2-one |
| SMILES | CCC=CCC(C=CC=CC=CC(CC=CCC=CCCC(C)=O)OPP)OP |
| InChI | InChI=1S/C23H37O3P3/c1-3-4-11-17-22(25-27)18-13-9-10-15-20-23(26-29-28)19-14-8-6-5-7-12-16-21(2)24/h4-5,7-11,13-15,18,20,22-23,29H,3,6,12,16-17,19,27-28H2,1-2H3 |
| InChIKey | VWBJKVMGKVHRTN-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|