C23H39OP — CID 121296204
[(3Z,8E,10E,12Z,15Z)-6-methyldocosa-3,8,10,12,15-pentaen-7-yl]oxyphosphane (PubChem CID 121296204) has the molecular formula C23H39OP and a molecular weight of 362.54 g/mol. Its IUPAC name is [(3Z,8E,10E,12Z,15Z)-6-methyldocosa-3,8,10,12,15-pentaen-7-yl]oxyphosphane.
| Compound Name | [(3Z,8E,10E,12Z,15Z)-6-methyldocosa-3,8,10,12,15-pentaen-7-yl]oxyphosphane |
|---|---|
| PubChem CID | 121296204 |
| Molecular Formula | C23H39OP |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | [(3Z,8E,10E,12Z,15Z)-6-methyldocosa-3,8,10,12,15-pentaen-7-yl]oxyphosphane |
| SMILES | CC/C=C\CC(C)C(/C=C/C=C/C=C\C/C=C\CCCCCC)OP |
| InChI | InChI=1S/C23H39OP/c1-4-6-8-9-10-11-12-13-14-15-16-17-19-21-23(24-25)22(3)20-18-7-5-2/h7,11-12,14-19,21-23H,4-6,8-10,13,20,25H2,1-3H3/b12-11-,15-14-,17-16+,18-7-,21-19+ |
| InChIKey | FYBIIFYXJRLXAB-AUNHNJPGSA-N |
| XLogP | 7.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|