C30H53N4O15P — CID 162289927
2-[4,7-bis(carboxymethyl)-10-[5-[2,3-di(butanoyloxy)propoxy-hydroxyphosphoryl]oxy-2-oxopentyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 162289927) has the molecular formula C30H53N4O15P and a molecular weight of 740.74 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[5-[2,3-di(butanoyloxy)propoxy-hydroxyphosphoryl]oxy-2-oxopentyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[5-[2,3-di(butanoyloxy)propoxy-hydroxyphosphoryl]oxy-2-oxopentyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 162289927 |
| Molecular Formula | C30H53N4O15P |
| Molecular Weight | 740.74 g/mol |
| Exact Mass | 740.32 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[5-[2,3-di(butanoyloxy)propoxy-hydroxyphosphoryl]oxy-2-oxopentyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCC(=O)OCC(COP(=O)(O)OCCCC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)OC(=O)CCC |
| InChI | InChI=1S/C30H53N4O15P/c1-3-6-29(42)46-22-25(49-30(43)7-4-2)23-48-50(44,45)47-17-5-8-24(35)18-31-9-11-32(19-26(36)37)13-15-34(21-28(40)41)16-14-33(12-10-31)20-27(38)39/h25H,3-23H2,1-2H3,(H,36,37)(H,38,39)(H,40,41)(H,44,45) |
| InChIKey | QIKDWMAWEDHKGX-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 250.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.74 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|