About cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron
cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron (PubChem CID 162292453) has the molecular formula C22H43FeN2P
and a molecular weight of 422.42 g/mol. Its IUPAC name is cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron.
Molecular Properties
| Compound Name | cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron |
| PubChem CID | 162292453 |
| Molecular Formula | C22H43FeN2P |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron |
| SMILES | C1CCCC1.CC[C@H]1CCCN1P(C1CCCC1)N1CCC[C@@H]1CC.[Fe] |
| InChI | InChI=1S/C17H33N2P.C5H10.Fe/c1-3-15-9-7-13-18(15)20(17-11-5-6-12-17)19-14-8-10-16(19)4-2;1-2-4-5-3-1;/h15-17H,3-14H2,1-2H3;1-5H2;/t15-,16-;;/m0../s1 |
| InChIKey | GEDKPPFADXZWAJ-SXBSVMRRSA-N |
| XLogP | 6.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron?
The IUPAC name of cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron (CID 162292453) is cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron.
What is the SMILES notation for cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron?
The canonical SMILES for cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron is C1CCCC1.CC[C@H]1CCCN1P(C1CCCC1)N1CCC[C@@H]1CC.[Fe].
What is the InChIKey of cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron?
The InChIKey is GEDKPPFADXZWAJ-SXBSVMRRSA-N. The full InChI is InChI=1S/C17H33N2P.C5H10.Fe/c1-3-15-9-7-13-18(15)20(17-11-5-6-12-17)19-14-8-10-16(19)4-2;1-2-4-5-3-1;/h15-17H,3-14H2,1-2H3;1-5H2;/t15-,16-;;/m0../s1.
What are the key properties of cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron?
cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron has a molecular weight of 422.42 g/mol, XLogP of 6.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;cyclopentyl-bis[(2S)-2-ethylpyrrolidin-1-yl]phosphane;iron is sourced from PubChem (CID 162292453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).