C23H36OSi — CID 162294814
cyclopentyl-[4-(4-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 162294814) has the molecular formula C23H36OSi and a molecular weight of 356.63 g/mol. Its IUPAC name is cyclopentyl-[4-(4-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | cyclopentyl-[4-(4-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 162294814 |
| Molecular Formula | C23H36OSi |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | cyclopentyl-[4-(4-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | COc1ccc(C2CCCC3C2CCC3[Si](C)(C)C2CCCC2)cc1 |
| InChI | InChI=1S/C23H36OSi/c1-24-18-13-11-17(12-14-18)20-9-6-10-22-21(20)15-16-23(22)25(2,3)19-7-4-5-8-19/h11-14,19-23H,4-10,15-16H2,1-3H3 |
| InChIKey | CBGCMDWVKLUQMQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|