C15H23N2+ — CID 162295477
2,4-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-azabicyclo[2.2.2]octane (PubChem CID 162295477) has the molecular formula C15H23N2+ and a molecular weight of 231.36 g/mol. Its IUPAC name is 2,4-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-azabicyclo[2.2.2]octane.
| Compound Name | 2,4-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 162295477 |
| Molecular Formula | C15H23N2+ |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 2,4-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-azabicyclo[2.2.2]octane |
| SMILES | CC1C(c2cccc[n+]2C)C2(C)CCN1CC2 |
| InChI | InChI=1S/C15H23N2/c1-12-14(13-6-4-5-9-16(13)3)15(2)7-10-17(12)11-8-15/h4-6,9,12,14H,7-8,10-11H2,1-3H3/q+1 |
| InChIKey | XQNRFTDQMSVOTK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|