C16H19N2S+ — CID 162296308
1,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-4-thia-8-azatricyclo[5.2.1.02,6]deca-2,5-diene (PubChem CID 162296308) has the molecular formula C16H19N2S+ and a molecular weight of 271.41 g/mol. Its IUPAC name is 1,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-4-thia-8-azatricyclo[5.2.1.02,6]deca-2,5-diene.
| Compound Name | 1,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-4-thia-8-azatricyclo[5.2.1.02,6]deca-2,5-diene |
|---|---|
| PubChem CID | 162296308 |
| Molecular Formula | C16H19N2S+ |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-4-thia-8-azatricyclo[5.2.1.02,6]deca-2,5-diene |
| SMILES | CC1N(c2cccc[n+]2C)C2CC1(C)c1cscc12 |
| InChI | InChI=1S/C16H19N2S/c1-11-16(2)8-14(12-9-19-10-13(12)16)18(11)15-6-4-5-7-17(15)3/h4-7,9-11,14H,8H2,1-3H3/q+1 |
| InChIKey | JZRBVXNUJXONOF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|