C18H22N3+ — CID 162296711
11-methyl-10-(1-methylpyridin-1-ium-2-yl)-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene (PubChem CID 162296711) has the molecular formula C18H22N3+ and a molecular weight of 280.40 g/mol. Its IUPAC name is 11-methyl-10-(1-methylpyridin-1-ium-2-yl)-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene.
| Compound Name | 11-methyl-10-(1-methylpyridin-1-ium-2-yl)-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 162296711 |
| Molecular Formula | C18H22N3+ |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 11-methyl-10-(1-methylpyridin-1-ium-2-yl)-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene |
| SMILES | CC1N2CCC(Cc3ccccc32)N1c1cccc[n+]1C |
| InChI | InChI=1S/C18H22N3/c1-14-20-12-10-16(13-15-7-3-4-8-17(15)20)21(14)18-9-5-6-11-19(18)2/h3-9,11,14,16H,10,12-13H2,1-2H3/q+1 |
| InChIKey | AYEQZKJNVFVGIK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|