C11H14N2 — CID 82411355
2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]indol-3-amine (PubChem CID 82411355) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]indol-3-amine.
| Compound Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]indol-3-amine |
|---|---|
| PubChem CID | 82411355 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]indol-3-amine |
| SMILES | NC1CCN2c3ccccc3CC12 |
| InChI | InChI=1S/C11H14N2/c12-9-5-6-13-10-4-2-1-3-8(10)7-11(9)13/h1-4,9,11H,5-7,12H2 |
| InChIKey | PUKBCOLUSBCKFH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |