C12H15NO — CID 82404420
1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-3-ol (PubChem CID 82404420) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-3-ol.
| Compound Name | 1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-3-ol |
|---|---|
| PubChem CID | 82404420 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-3-ol |
| SMILES | OC1CCN2c3ccccc3CCC12 |
| InChI | InChI=1S/C12H15NO/c14-12-7-8-13-10-4-2-1-3-9(10)5-6-11(12)13/h1-4,11-12,14H,5-8H2 |
| InChIKey | XOECLAIZUVAIOA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |