C15H20N2O2 — CID 77033802
2-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)cyclohexan-1-ol (PubChem CID 77033802) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)cyclohexan-1-ol.
| Compound Name | 2-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 77033802 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)cyclohexan-1-ol |
| SMILES | ON=C1CCN(C2CCCCC2O)c2ccccc21 |
| InChI | InChI=1S/C15H20N2O2/c18-15-8-4-3-7-14(15)17-10-9-12(16-19)11-5-1-2-6-13(11)17/h1-2,5-6,14-15,18-19H,3-4,7-10H2 |
| InChIKey | DAHGEUMACHTSHX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|