C22H33N2+ — CID 162296893
5,5-dideuterio-2,4,4-trimethyl-3-(2-methylphenyl)spiro[1,3-diazolidin-1-ium-1,2'-2-azoniatricyclo[3.3.1.13,7]decane] (PubChem CID 162296893) has the molecular formula C22H33N2+ and a molecular weight of 327.53 g/mol. Its IUPAC name is 5,5-dideuterio-2,4,4-trimethyl-3-(2-methylphenyl)spiro[1,3-diazolidin-1-ium-1,2'-2-azoniatricyclo[3.3.1.13,7]decane].
| Compound Name | 5,5-dideuterio-2,4,4-trimethyl-3-(2-methylphenyl)spiro[1,3-diazolidin-1-ium-1,2'-2-azoniatricyclo[3.3.1.13,7]decane] |
|---|---|
| PubChem CID | 162296893 |
| Molecular Formula | C22H33N2+ |
| Molecular Weight | 327.53 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | 5,5-dideuterio-2,4,4-trimethyl-3-(2-methylphenyl)spiro[1,3-diazolidin-1-ium-1,2'-2-azoniatricyclo[3.3.1.13,7]decane] |
| SMILES | [2H]C1([2H])C(C)(C)N(c2ccccc2C)C(C)[N+]12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C22H33N2/c1-15-7-5-6-8-21(15)23-16(2)24(14-22(23,3)4)19-10-17-9-18(12-19)13-20(24)11-17/h5-8,16-20H,9-14H2,1-4H3/q+1/i14D2 |
| InChIKey | KBJVMOVXLQTWJP-FNHLFAINSA-N |
| XLogP | 4.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|