C12H17ClI6N5O2- — CID 162300002
4-N-[2-(3-methyl-2H-imidazol-1-yl)ethyl]-2-nitrobenzene-1,4-diamine;tris(molecular iodine);chloride (PubChem CID 162300002) has the molecular formula C12H17ClI6N5O2- and a molecular weight of 1060.18 g/mol. Its IUPAC name is 4-N-[2-(3-methyl-2H-imidazol-1-yl)ethyl]-2-nitrobenzene-1,4-diamine;tris(molecular iodine);chloride.
| Compound Name | 4-N-[2-(3-methyl-2H-imidazol-1-yl)ethyl]-2-nitrobenzene-1,4-diamine;tris(molecular iodine);chloride |
|---|---|
| PubChem CID | 162300002 |
| Molecular Formula | C12H17ClI6N5O2- |
| Molecular Weight | 1060.18 g/mol |
| Exact Mass | 1059.53 |
| IUPAC Name | 4-N-[2-(3-methyl-2H-imidazol-1-yl)ethyl]-2-nitrobenzene-1,4-diamine;tris(molecular iodine);chloride |
| SMILES | CN1C=CN(CCNc2ccc(N)c([N+](=O)[O-])c2)C1.II.II.II.[Cl-] |
| InChI | InChI=1S/C12H17N5O2.ClH.3I2/c1-15-6-7-16(9-15)5-4-14-10-2-3-11(13)12(8-10)17(18)19;;3*1-2/h2-3,6-8,14H,4-5,9,13H2,1H3;1H;;;/p-1 |
| InChIKey | AWUGHVXJEAPECS-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|