C12H24N2O3S2 — CID 162302848
tert-butyl 2-[[2-[bis(sulfanyl)methyl-methylamino]acetyl]amino]-2-methylpropanoate (PubChem CID 162302848) has the molecular formula C12H24N2O3S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is tert-butyl 2-[[2-[bis(sulfanyl)methyl-methylamino]acetyl]amino]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[[2-[bis(sulfanyl)methyl-methylamino]acetyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 162302848 |
| Molecular Formula | C12H24N2O3S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | tert-butyl 2-[[2-[bis(sulfanyl)methyl-methylamino]acetyl]amino]-2-methylpropanoate |
| SMILES | CN(CC(=O)NC(C)(C)C(=O)OC(C)(C)C)C(S)S |
| InChI | InChI=1S/C12H24N2O3S2/c1-11(2,3)17-9(16)12(4,5)13-8(15)7-14(6)10(18)19/h10,18-19H,7H2,1-6H3,(H,13,15) |
| InChIKey | ZMFQLRWEACLBLC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|