C25H48 — CID 162304109
3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecamethylundeca-1,10-diene (PubChem CID 162304109) has the molecular formula C25H48 and a molecular weight of 348.66 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecamethylundeca-1,10-diene.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecamethylundeca-1,10-diene |
|---|---|
| PubChem CID | 162304109 |
| Molecular Formula | C25H48 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 348.38 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecamethylundeca-1,10-diene |
| SMILES | C=CC(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C=C |
| InChI | InChI=1S/C25H48/c1-17-19(3,4)21(7,8)23(11,12)25(15,16)24(13,14)22(9,10)20(5,6)18-2/h17-18H,1-2H2,3-16H3 |
| InChIKey | ARYJFZHZVHBBLJ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|