C2H3F5LiO4P — CID 162308540
lithium;1,1,1,2,2-pentafluoroethane;phosphoric acid (PubChem CID 162308540) has the molecular formula C2H3F5LiO4P and a molecular weight of 223.95 g/mol. Its IUPAC name is lithium;1,1,1,2,2-pentafluoroethane;phosphoric acid.
| Compound Name | lithium;1,1,1,2,2-pentafluoroethane;phosphoric acid |
|---|---|
| PubChem CID | 162308540 |
| Molecular Formula | C2H3F5LiO4P |
| Molecular Weight | 223.95 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | lithium;1,1,1,2,2-pentafluoroethane;phosphoric acid |
| SMILES | F[C-](F)C(F)(F)F.O=P(O)(O)O.[Li+] |
| InChI | InChI=1S/C2F5.Li.H3O4P/c3-1(4)2(5,6)7;;1-5(2,3)4/h;;(H3,1,2,3,4)/q-1;+1; |
| InChIKey | ZKAIPIYBXWBZEJ-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.95 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|