C12H20Cl2N2O — CID 162311849
2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine;dihydrochloride (PubChem CID 162311849) has the molecular formula C12H20Cl2N2O and a molecular weight of 279.21 g/mol. Its IUPAC name is 2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine;dihydrochloride.
| Compound Name | 2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 162311849 |
| Molecular Formula | C12H20Cl2N2O |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine;dihydrochloride |
| SMILES | Cc1c(C)c2c(c(N)c1N)CC(C)(C)O2.Cl.Cl |
| InChI | InChI=1S/C12H18N2O.2ClH/c1-6-7(2)11-8(10(14)9(6)13)5-12(3,4)15-11;;/h5,13-14H2,1-4H3;2*1H |
| InChIKey | IFYNJOCNXHVZJM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|