C20H28ClN3O5 — CID 162323681
(3S)-3-amino-N-[(2S)-1-[(3R,4S)-1-methoxy-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide;hydrochloride (PubChem CID 162323681) has the molecular formula C20H28ClN3O5 and a molecular weight of 425.91 g/mol. Its IUPAC name is (3S)-3-amino-N-[(2S)-1-[(3R,4S)-1-methoxy-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide;hydrochloride.
| Compound Name | (3S)-3-amino-N-[(2S)-1-[(3R,4S)-1-methoxy-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 162323681 |
| Molecular Formula | C20H28ClN3O5 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (3S)-3-amino-N-[(2S)-1-[(3R,4S)-1-methoxy-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide;hydrochloride |
| SMILES | CON1C(=O)[C@@H](C(=O)[C@@H](NC(=O)C[C@H](N)c2ccccc2)C(C)C)[C@H](C)C1=O.Cl |
| InChI | InChI=1S/C20H27N3O5.ClH/c1-11(2)17(18(25)16-12(3)19(26)23(28-4)20(16)27)22-15(24)10-14(21)13-8-6-5-7-9-13;/h5-9,11-12,14,16-17H,10,21H2,1-4H3,(H,22,24);1H/t12-,14-,16+,17-;/m0./s1 |
| InChIKey | WIMJVQFYIAKQSN-HXYQUFCRSA-N |
| XLogP | 1.39 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|